CAS 1992957-13-7 appears in our catalog under these names: 4-Amino-4-[(2-chlorophenyl)methyl]-1lambda(6)-thiane-1,1-dione hydrochloride, 95%, 4-Amino-4-(2-chlorobenzyl)tetrahydro-2H-thiopyran 1,1-dioxide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride (CAS 1992957-13-7) is a chemical compound with the molecular formula C12H17Cl2NO2S and a molecular weight of 310.2 g/mol. IUPAC name: 4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride. InChIKey: XIJKZDUQNDMATC-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO2S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4-[(2-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride |
| InChIKey | XIJKZDUQNDMATC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)