CAS 2490698-17-2 is the registry number for 4-(3-chlorobenzyl)tetrahydro-2H-thiopyran-4-amine 1,1-dioxide hydrochloride (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-[(3-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride (CAS 2490698-17-2) is a chemical compound with the molecular formula C12H17Cl2NO2S and a molecular weight of 310.2 g/mol. IUPAC name: 4-[(3-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride. InChIKey: ADVRITNFPNKQBW-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO2S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methyl]-1,1-dioxothian-4-amine;hydrochloride |
| InChIKey | ADVRITNFPNKQBW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)