Products 1993176-29-6
CAS 1993176-29-6 is the registry number for 1-[2-(3-Chlorophenyl)-2-hydroxyethyl]-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-[2-(3-chlorophenyl)-2-hydroxyethyl]-1,2,4-triazole-3-carboxylic acid (CAS 1993176-29-6) is a chemical compound with the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. IUPAC name: 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-1,2,4-triazole-3-carboxylic acid. InChIKey: TYGWTEYWVWTMBF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O3 |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-1,2,4-triazole-3-carboxylic acid |
| InChIKey | TYGWTEYWVWTMBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(CN2C=NC(=N2)C(=O)O)O |
Computed by PubChem (NCBI)