CAS 932976-16-4 is the registry number for 1-(3-Chloro-4-methoxyphenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-chloro-4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid (CAS 932976-16-4) is a chemical compound with the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. IUPAC name: 1-(3-chloro-4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: CMSQWJTXFVHHFJ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O3 |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | 1-(3-chloro-4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | CMSQWJTXFVHHFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC(=C(C=C2)OC)Cl)C(=O)O |
Computed by PubChem (NCBI)