Products 1993178-75-8
CAS 1993178-75-8 appears in our catalog under these names: 3-(Benzyloxy)azetidine benzenesulfonate, 98%, 98%, 3-(Benzyloxy)azetidine benzenesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzenesulfonic acid;3-phenylmethoxyazetidine (CAS 1993178-75-8) is a chemical compound with the molecular formula C16H19NO4S and a molecular weight of 321.4 g/mol. IUPAC name: benzenesulfonic acid;3-phenylmethoxyazetidine. InChIKey: PUVCBEHNDGDSDT-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4S |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | benzenesulfonic acid;3-phenylmethoxyazetidine |
| InChIKey | PUVCBEHNDGDSDT-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OCC2=CC=CC=C2.C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)