Products 911197-39-2
CAS 911197-39-2 is the registry number for N-(2,4-Dimethoxybenzyl)-4-methylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,4-dimethoxyphenyl)methyl]-4-methylbenzenesulfonamide (CAS 911197-39-2) is a chemical compound with the molecular formula C16H19NO4S and a molecular weight of 321.4 g/mol. IUPAC name: N-[(2,4-dimethoxyphenyl)methyl]-4-methylbenzenesulfonamide. InChIKey: ODKWLXNVJCWZIP-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4S |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | N-[(2,4-dimethoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| InChIKey | ODKWLXNVJCWZIP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)