CAS 1993648-80-8 is the registry number for N1-[(1E)-(4-Methylphenyl)methylene]-4-phenyl-1h-imidazole-1,2-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(E)-(4-methylphenyl)methylideneamino]-4-phenylimidazol-2-amine (CAS 1993648-80-8) is a chemical compound with the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. IUPAC name: 1-[(E)-(4-methylphenyl)methylideneamino]-4-phenylimidazol-2-amine. InChIKey: IVUWSPQZUXMERQ-YBFXNURJSA-N.
| Molecular formula | C17H16N4 |
|---|---|
| Molecular weight | 276.34 g/mol |
| IUPAC name | 1-[(E)-(4-methylphenyl)methylideneamino]-4-phenylimidazol-2-amine |
| InChIKey | IVUWSPQZUXMERQ-YBFXNURJSA-N |
| SMILES | CC1=CC=C(C=C1)/C=N/N2C=C(N=C2N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)