CAS 413620-13-0 appears in our catalog under these names: 2-(1-Methylhydrazino)-4,6-diphenylpyrimidine, 95%, 2-(1-Methylhydrazinyl)-4,6-diphenylpyrimidine, 97%, 2-(1-Methylhydrazino)-4,6-diphenylpyrimidine, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
1-(4,6-diphenylpyrimidin-2-yl)-1-methylhydrazine (CAS 413620-13-0) is a chemical compound with the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. IUPAC name: 1-(4,6-diphenylpyrimidin-2-yl)-1-methylhydrazine. InChIKey: TZLATRIAIDVTTD-UHFFFAOYSA-N.
| Molecular formula | C17H16N4 |
|---|---|
| Molecular weight | 276.34 g/mol |
| IUPAC name | 1-(4,6-diphenylpyrimidin-2-yl)-1-methylhydrazine |
| InChIKey | TZLATRIAIDVTTD-UHFFFAOYSA-N |
| SMILES | CN(C1=NC(=CC(=N1)C2=CC=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)