Products 1995864-97-5
CAS 1995864-97-5 is the registry number for 2-Et-AZT. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,4S,5S)-4-azido-5-(ethoxymethyl)oxolan-2-yl]-3-ethyl-5-methylpyrimidine-2,4-dione (CAS 1995864-97-5) is a chemical compound with the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. IUPAC name: 1-[(2R,4S,5S)-4-azido-5-(ethoxymethyl)oxolan-2-yl]-3-ethyl-5-methylpyrimidine-2,4-dione. InChIKey: BHARZHMUBAZJBJ-QJPTWQEYSA-N.
| Molecular formula | C14H21N5O4 |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-azido-5-(ethoxymethyl)oxolan-2-yl]-3-ethyl-5-methylpyrimidine-2,4-dione |
| InChIKey | BHARZHMUBAZJBJ-QJPTWQEYSA-N |
| SMILES | CCN1C(=O)C(=CN(C1=O)[C@H]2C[C@@H]([C@H](O2)COCC)N=[N+]=[N-])C |
Computed by PubChem (NCBI)