CAS 236389-19-8 is the registry number for 2'-Deoxy-N2,N2-diethyl guanosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(diethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 236389-19-8) is a chemical compound with the molecular formula C14H21N5O4 and a molecular weight of 323.35 g/mol. IUPAC name: 2-(diethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: JLKDOZVYGPEKBD-IVZWLZJFSA-N.
| Molecular formula | C14H21N5O4 |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | 2-(diethylamino)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | JLKDOZVYGPEKBD-IVZWLZJFSA-N |
| SMILES | CCN(CC)C1=NC2=C(C(=O)N1)N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)