CAS 1996223-87-0 is the registry number for rac-(3R,4S)-4-(1H-Pyrazol-1-yl)oxolan-3-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,4R)-4-pyrazol-1-yloxolan-3-ol (CAS 1996223-87-0) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: (3S,4R)-4-pyrazol-1-yloxolan-3-ol. InChIKey: HIRGWBVTTJZGEB-RNFRBKRXSA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | (3S,4R)-4-pyrazol-1-yloxolan-3-ol |
| InChIKey | HIRGWBVTTJZGEB-RNFRBKRXSA-N |
| SMILES | C1[C@H]([C@@H](CO1)O)N2C=CC=N2 |
Computed by PubChem (NCBI)