CAS 199788-52-8 appears in our catalog under these names: Alpha-methyl 2,4-dichlorochalcone, 95%, α-Methyl 2,4-dichlorochalcone, α-Methyl 2,4-dichlorochalcone, min. 95 %, 10 g, α-Methyl 2,4-dichlorochalcone, min. 95 %, 25 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g.
(E)-3-(2,4-dichlorophenyl)-2-methyl-1-phenylprop-2-en-1-one (CAS 199788-52-8) is a chemical compound with the molecular formula C16H12Cl2O and a molecular weight of 291.2 g/mol. IUPAC name: (E)-3-(2,4-dichlorophenyl)-2-methyl-1-phenylprop-2-en-1-one. InChIKey: DVGSUKMFYKORJS-PKNBQFBNSA-N.
| Molecular formula | C16H12Cl2O |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | (E)-3-(2,4-dichlorophenyl)-2-methyl-1-phenylprop-2-en-1-one |
| InChIKey | DVGSUKMFYKORJS-PKNBQFBNSA-N |
| SMILES | C/C(=C\C1=C(C=C(C=C1)Cl)Cl)/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)