CAS 4800-46-8 appears in our catalog under these names: Sertraline Impurity 6, Sertraline Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one (CAS 4800-46-8) is a chemical compound with the molecular formula C16H12Cl2O and a molecular weight of 291.2 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: KVRLTPTTWHLTED-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2O |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | KVRLTPTTWHLTED-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(=O)C1C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)