CAS 19985-79-6 is the registry number for 2,3-Bis(1,1-dimethylethyl)-2-cyclopropen-1-one. Offered by: TRC. Available pack sizes: 250mg.
2,3-ditert-butylcycloprop-2-en-1-one (CAS 19985-79-6) is a chemical compound with the molecular formula C11H18O and a molecular weight of 166.26 g/mol. IUPAC name: 2,3-ditert-butylcycloprop-2-en-1-one. InChIKey: NLSBZJJINHYWGM-UHFFFAOYSA-N.
| Molecular formula | C11H18O |
|---|---|
| Molecular weight | 166.26 g/mol |
| IUPAC name | 2,3-ditert-butylcycloprop-2-en-1-one |
| InChIKey | NLSBZJJINHYWGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C1=O)C(C)(C)C |
Computed by PubChem (NCBI)