CAS 19989-35-6 appears in our catalog under these names: 6-Acetylbenzothiazole, 6-Acetylbenzothiazole, 95%, 6-Acetylbenzothiazole, 95+%. Offered by: TRC, Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 100mg, 1g.
1-(1,3-benzothiazol-6-yl)ethanone (CAS 19989-35-6) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 1-(1,3-benzothiazol-6-yl)ethanone. InChIKey: KHIQJRVZQJFYKD-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-6-yl)ethanone |
| InChIKey | KHIQJRVZQJFYKD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N=CS2 |
Computed by PubChem (NCBI)