Products 20002-23-7
CAS 20002-23-7 appears in our catalog under these names: N-Nitrosodibenzylamine-d4, >95% (HPLC), N-Nitrosodibenzylamine-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 2mg, 1mg, 25mg, 10mg, 50 mg, 5 mg.
N,N-bis[dideuterio(phenyl)methyl]nitrous amide (CAS 20002-23-7) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 230.30 g/mol. IUPAC name: N,N-bis[dideuterio(phenyl)methyl]nitrous amide. InChIKey: RZJLAUZAMYYGMS-AREBVXNXSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | N,N-bis[dideuterio(phenyl)methyl]nitrous amide |
| InChIKey | RZJLAUZAMYYGMS-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)N(C([2H])([2H])C2=CC=CC=C2)N=O |
Computed by PubChem (NCBI)