CAS 2001096-62-2 is the registry number for N-(2,6-Dimethylphenyl)-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dimethyl-N-(4-phenylphenyl)aniline (CAS 2001096-62-2) is a chemical compound with the molecular formula C20H19N and a molecular weight of 273.4 g/mol. IUPAC name: 2,6-dimethyl-N-(4-phenylphenyl)aniline. InChIKey: CAKKCHCHJPZHCY-UHFFFAOYSA-N.
| Molecular formula | C20H19N |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 2,6-dimethyl-N-(4-phenylphenyl)aniline |
| InChIKey | CAKKCHCHJPZHCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)