CAS 100430-66-8 is the registry number for (S,E)-1-(Naphthalen-1-yl)-N-(1-phenylethyl)ethan-1-imine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-naphthalen-1-yl-N-[(1S)-1-phenylethyl]ethanimine (CAS 100430-66-8) is a chemical compound with the molecular formula C20H19N and a molecular weight of 273.4 g/mol. IUPAC name: 1-naphthalen-1-yl-N-[(1S)-1-phenylethyl]ethanimine. InChIKey: LWYGKPGNUHCTCL-HNNXBMFYSA-N.
| Molecular formula | C20H19N |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 1-naphthalen-1-yl-N-[(1S)-1-phenylethyl]ethanimine |
| InChIKey | LWYGKPGNUHCTCL-HNNXBMFYSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N=C(C)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)