CAS 13511-11-0 appears in our catalog under these names: N,N–Di–m–tolylaniline, 3,3'-Dimethyltriphenylamine, >98.0%(GC), 3,3'-Dimethyltriphenylamine 98%, 3,3'-Dimethyltriphenylamine, 98%, 98%, N,N-Bis(m-tolyl)aniline, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g.
3-methyl-N-(3-methylphenyl)-N-phenylaniline (CAS 13511-11-0) is a chemical compound with the molecular formula C20H19N and a molecular weight of 273.4 g/mol. IUPAC name: 3-methyl-N-(3-methylphenyl)-N-phenylaniline. InChIKey: ZCAWQFNYHFHEPZ-UHFFFAOYSA-N.
| Molecular formula | C20H19N |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 3-methyl-N-(3-methylphenyl)-N-phenylaniline |
| InChIKey | ZCAWQFNYHFHEPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=CC(=C3)C |
Computed by PubChem (NCBI)