Products 2001608-46-2

CAS 2001608-46-2 is the registry number for Rel-(1s,3s)-1-amino-3-fluoro-3-methylcyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-amino-3-fluoro-3-methylcyclobutane-1-carboxylic acid (CAS 2001608-46-2) is a chemical compound with the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. IUPAC name: 1-amino-3-fluoro-3-methylcyclobutane-1-carboxylic acid. InChIKey: ILMJJAKSEOUEPX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10FNO2
Molecular weight147.15 g/mol
IUPAC name1-amino-3-fluoro-3-methylcyclobutane-1-carboxylic acid
InChIKeyILMJJAKSEOUEPX-UHFFFAOYSA-N
SMILESCC1(CC(C1)(C(=O)O)N)F

Computed by PubChem (NCBI)