Products 200188-53-0
CAS 200188-53-0 is the registry number for 4-Nitro-Z-D-Arg-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g, 25g.
(2R)-5-(diaminomethylideneamino)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid (CAS 200188-53-0) is a chemical compound with the molecular formula C14H19N5O6 and a molecular weight of 353.33 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid. InChIKey: AMKFUKMKVGMLAK-LLVKDONJSA-N.
| Molecular formula | C14H19N5O6 |
|---|---|
| Molecular weight | 353.33 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-[(4-nitrophenyl)methoxycarbonylamino]pentanoic acid |
| InChIKey | AMKFUKMKVGMLAK-LLVKDONJSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)N[C@H](CCCN=C(N)N)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)