Products 2279-08-5
CAS 2279-08-5 appears in our catalog under these names: Z-D-Arg(NO2)-OH, 97%, Z-D-Arg(NO2)-OH. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 100g, 5g, 25g, 1g.
(2R)-5-[[amino(nitramido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 2279-08-5) is a chemical compound with the molecular formula C14H19N5O6 and a molecular weight of 353.33 g/mol. IUPAC name: (2R)-5-[[amino(nitramido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: BZPCSFNCKORLQG-LLVKDONJSA-N.
| Molecular formula | C14H19N5O6 |
|---|---|
| Molecular weight | 353.33 g/mol |
| IUPAC name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | BZPCSFNCKORLQG-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCCN=C(N)N[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)