Products 200189-97-5
CAS 200189-97-5 appears in our catalog under these names: CGP 3466B maleate, Omigapil Maleate, CGP 3466B maleate/ 98.96% (existing batch purity), CGP 3466 (maleate), 98.96% ,, 98.96% ,, Omigapil (maleate), 99.84%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 2mg, 25mg, 50mg, 25 mg, 10 mg, 50 mg.
N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-methylprop-2-yn-1-amine;(Z)-but-2-enedioic acid (CAS 200189-97-5) is a chemical compound with the molecular formula C23H21NO5 and a molecular weight of 391.4 g/mol. IUPAC name: N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-methylprop-2-yn-1-amine;(Z)-but-2-enedioic acid. InChIKey: SQAZQLMBEHYFJA-BTJKTKAUSA-N.
| Molecular formula | C23H21NO5 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-methylprop-2-yn-1-amine;(Z)-but-2-enedioic acid |
| InChIKey | SQAZQLMBEHYFJA-BTJKTKAUSA-N |
| SMILES | CN(CC#C)CC1=CC2=CC=CC=C2OC3=CC=CC=C31.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)