CAS 270596-34-4 appears in our catalog under these names: Fmoc-(r)-3-amino-4-(2-furyl)-butyric acid, 95%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(furan-2-yl)butanoic acid, 95+%, Fmoc-(R)-3-Amino-4-(2-furyl)-butyric acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 25mg.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(furan-2-yl)butanoic acid (CAS 270596-34-4) is a chemical compound with the molecular formula C23H21NO5 and a molecular weight of 391.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(furan-2-yl)butanoic acid. InChIKey: YIYJEKXVMOCXPC-OAHLLOKOSA-N.
| Molecular formula | C23H21NO5 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(furan-2-yl)butanoic acid |
| InChIKey | YIYJEKXVMOCXPC-OAHLLOKOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=CO4)CC(=O)O |
Computed by PubChem (NCBI)