Products 200276-64-8
CAS 200276-64-8 is the registry number for Z-D-Asn(Mtt)-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
(2R)-4-amino-2-[[(4-methylphenyl)-diphenylmethyl]-phenylmethoxycarbonylamino]-4-oxobutanoic acid (CAS 200276-64-8) is a chemical compound with the molecular formula C32H30N2O5 and a molecular weight of 522.6 g/mol. IUPAC name: (2R)-4-amino-2-[[(4-methylphenyl)-diphenylmethyl]-phenylmethoxycarbonylamino]-4-oxobutanoic acid. InChIKey: XEDRAXVRGRHLCZ-MUUNZHRXSA-N.
| Molecular formula | C32H30N2O5 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | (2R)-4-amino-2-[[(4-methylphenyl)-diphenylmethyl]-phenylmethoxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | XEDRAXVRGRHLCZ-MUUNZHRXSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N([C@H](CC(=O)N)C(=O)O)C(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)