CAS 144317-18-0 appears in our catalog under these names: Z-Asn(Mtt)-OH, Z-Asn(Mtt)-OH, >95% (HPLC), Z–Asn(Mtt)–OH. Offered by: Creative Peptides, TRC, GLPBio. Available pack sizes: 5g, 25g, 100mg, 500mg, 50mg.
(2S)-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 144317-18-0) is a chemical compound with the molecular formula C32H30N2O5 and a molecular weight of 522.6 g/mol. IUPAC name: (2S)-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: OOWKUTRZJDOGPF-NDEPHWFRSA-N.
| Molecular formula | C32H30N2O5 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | (2S)-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | OOWKUTRZJDOGPF-NDEPHWFRSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@@H](C(=O)O)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)