CAS 2112718-83-7 is the registry number for (R)-5-Amino-2-(((benzyloxy)carbonyl)(trityl)amino)-5-oxopentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
(2R)-5-amino-5-oxo-2-[phenylmethoxycarbonyl(trityl)amino]pentanoic acid (CAS 2112718-83-7) is a chemical compound with the molecular formula C32H30N2O5 and a molecular weight of 522.6 g/mol. IUPAC name: (2R)-5-amino-5-oxo-2-[phenylmethoxycarbonyl(trityl)amino]pentanoic acid. InChIKey: UMBDCOHCTVLOSZ-MUUNZHRXSA-N.
| Molecular formula | C32H30N2O5 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | (2R)-5-amino-5-oxo-2-[phenylmethoxycarbonyl(trityl)amino]pentanoic acid |
| InChIKey | UMBDCOHCTVLOSZ-MUUNZHRXSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N([C@H](CCC(=O)N)C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)