CAS 200335-70-2 is the registry number for 5,6-Diamino-1,3-dimethylpyrimidine-2,4(1H,3H)-dione hydrate, 97%. Offered by: AmBeed. Available pack sizes: 25g, 10g.
5,6-diamino-1,3-dimethylpyrimidine-2,4-dione;hydrate (CAS 200335-70-2) is a chemical compound with the molecular formula C6H12N4O3 and a molecular weight of 188.18 g/mol. IUPAC name: 5,6-diamino-1,3-dimethylpyrimidine-2,4-dione;hydrate. InChIKey: FNLDCZCNGSQKIC-UHFFFAOYSA-N.
| Molecular formula | C6H12N4O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5,6-diamino-1,3-dimethylpyrimidine-2,4-dione;hydrate |
| InChIKey | FNLDCZCNGSQKIC-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)N)N.O |
Computed by PubChem (NCBI)