CAS 4862-18-4 appears in our catalog under these names: Allopurinol Impurity 5, Oxiracetam Impurity 31. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[bis(2-amino-2-oxoethyl)amino]acetamide (CAS 4862-18-4) is a chemical compound with the molecular formula C6H12N4O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2-[bis(2-amino-2-oxoethyl)amino]acetamide. InChIKey: CVTGEDNIBVTKBJ-UHFFFAOYSA-N.
| Molecular formula | C6H12N4O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-[bis(2-amino-2-oxoethyl)amino]acetamide |
| InChIKey | CVTGEDNIBVTKBJ-UHFFFAOYSA-N |
| SMILES | C(C(=O)N)N(CC(=O)N)CC(=O)N |
Computed by PubChem (NCBI)