Products 2004303-09-5
CAS 2004303-09-5 is the registry number for tert-butyl N-(1-cyanocyclopropyl)-N-methylcarbamate, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(1-cyanocyclopropyl)-N-methylcarbamate (CAS 2004303-09-5) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: tert-butyl N-(1-cyanocyclopropyl)-N-methylcarbamate. InChIKey: GYBKIVVBHCBURJ-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | tert-butyl N-(1-cyanocyclopropyl)-N-methylcarbamate |
| InChIKey | GYBKIVVBHCBURJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1(CC1)C#N |
Computed by PubChem (NCBI)