CAS 20053-66-1 appears in our catalog under these names: Deoxyisobaimuxino, Isodihydroagarofuran, α-Agarofuran, dihydro- (7CI),, Dihydro-alpha-agarofuran. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
Dihydroagarofuran is a eudesmane sesquiterpenoid that is octahydro-2H-3,9a-methano-1-benzoxepine substituted by methyl groups at positions 2, 2, 5a and 9 (the 3R,5aS,9R,9aS stereoisomer). It has a role as a metabolite. It is an organic heterotricyclic compound, a bridged compound, a cyclic ether and a eudesmane sesquiterpenoid.
Source: ChEBI
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1S,2R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecane |
| InChIKey | HVAVUZLEYSAYGE-UXOAXIEHSA-N |
| SMILES | C[C@@H]1CCC[C@@]2([C@]13C[C@@H](CC2)C(O3)(C)C)C |
Computed by PubChem (NCBI)