CAS 20061-59-0 is the registry number for 2-Nitro-9H-xanthen-9-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-nitroxanthen-9-one (CAS 20061-59-0) is a chemical compound with the molecular formula C13H7NO4 and a molecular weight of 241.20 g/mol. IUPAC name: 2-nitroxanthen-9-one. InChIKey: NDCNIDLJNJJHRA-UHFFFAOYSA-N.
| Molecular formula | C13H7NO4 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 2-nitroxanthen-9-one |
| InChIKey | NDCNIDLJNJJHRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)