CAS 247128-17-2 is the registry number for 1,3-Dioxo-2,3-dihydro-1H-benzo[de]isoquinoline-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (CAS 247128-17-2) is a chemical compound with the molecular formula C13H7NO4 and a molecular weight of 241.20 g/mol. IUPAC name: 1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid. InChIKey: CQMSFSGRORDUGC-UHFFFAOYSA-N.
| Molecular formula | C13H7NO4 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| InChIKey | CQMSFSGRORDUGC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)NC3=O)C(=O)O |
Computed by PubChem (NCBI)