CAS 20062-24-2 is the registry number for p-Azidoacetophenone, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
1-(4-azidophenyl)ethanone (CAS 20062-24-2) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 1-(4-azidophenyl)ethanone. InChIKey: HYRIDYFBEXCCIA-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 1-(4-azidophenyl)ethanone |
| InChIKey | HYRIDYFBEXCCIA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)