Products 20062-91-3
CAS 20062-91-3 appears in our catalog under these names: 3-(4-Phenoxyphenyl)propanoic acid, 96%, 3-(4-Phenoxyphenyl)propanoic acid 98%, 3-(4-Phenoxyphenyl)propanoic acid, 98%, 98%, 3-(4-Phenoxyphenyl)propionic acid, 98%(LC-MS),RG. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
3-(4-phenoxyphenyl)propanoic acid (CAS 20062-91-3) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 3-(4-phenoxyphenyl)propanoic acid. InChIKey: XNZKHFWFUASCFO-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)propanoic acid |
| InChIKey | XNZKHFWFUASCFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)