CAS 200624-59-5 appears in our catalog under these names: H–D–Gln–NH₂ · HCl, H-D-Gln-nh2 hydrochloride, 95%, H-D-Gln-NH2.HCl, 98%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-aminopentanediamide;hydrochloride (CAS 200624-59-5) is a chemical compound with the molecular formula C5H12ClN3O2 and a molecular weight of 181.62 g/mol. IUPAC name: (2R)-2-aminopentanediamide;hydrochloride. InChIKey: XXIALTSAXCJAST-AENDTGMFSA-N.
| Molecular formula | C5H12ClN3O2 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (2R)-2-aminopentanediamide;hydrochloride |
| InChIKey | XXIALTSAXCJAST-AENDTGMFSA-N |
| SMILES | C(CC(=O)N)[C@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)