CAS 71431-66-8 appears in our catalog under these names: H-Ala-gly-nh2 hydrochloride, 95%, H–Ala–Gly–NH₂ · HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-amino-N-(2-amino-2-oxoethyl)propanamide;hydrochloride (CAS 71431-66-8) is a chemical compound with the molecular formula C5H12ClN3O2 and a molecular weight of 181.62 g/mol. IUPAC name: (2S)-2-amino-N-(2-amino-2-oxoethyl)propanamide;hydrochloride. InChIKey: SUCIQLIGRKFZNE-DFWYDOINSA-N.
| Molecular formula | C5H12ClN3O2 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (2S)-2-amino-N-(2-amino-2-oxoethyl)propanamide;hydrochloride |
| InChIKey | SUCIQLIGRKFZNE-DFWYDOINSA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)N)N.Cl |
Computed by PubChem (NCBI)