Products 2006272-96-2
CAS 2006272-96-2 appears in our catalog under these names: trans-Caryophyllene-d2 (beta-Caryophyllene-d2), β–Caryophyllene–d2, β-Caryophyllene-d2, 94%, 94%, β-Caryophyllene-d2, 94.22%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 1 mg, 500 μg.
(1R,4Z,9S)-8-(dideuteriomethylidene)-4,11,11-trimethylbicyclo[7.2.0]undec-4-ene (CAS 2006272-96-2) is a chemical compound with the molecular formula C15H24 and a molecular weight of 206.36 g/mol. IUPAC name: (1R,4Z,9S)-8-(dideuteriomethylidene)-4,11,11-trimethylbicyclo[7.2.0]undec-4-ene. InChIKey: NPNUFJAVOOONJE-DUOVYBGSSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 206.36 g/mol |
| IUPAC name | (1R,4Z,9S)-8-(dideuteriomethylidene)-4,11,11-trimethylbicyclo[7.2.0]undec-4-ene |
| InChIKey | NPNUFJAVOOONJE-DUOVYBGSSA-N |
| SMILES | [2H]C(=C1CC/C=C(\CC[C@@H]2[C@@H]1CC2(C)C)/C)[2H] |
Computed by PubChem (NCBI)