CAS 2007-97-8 appears in our catalog under these names: 1,2-Phenylene phosphorotrichloridite, 95%, 2,2,2-Trichloro-1,3,2 lambda-5-benzodioxaphosphole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g, 250g.
2,2,2-trichloro-1,3,2lambda5-benzodioxaphosphole (CAS 2007-97-8) is a chemical compound with the molecular formula C6H4Cl3O2P and a molecular weight of 245.4 g/mol. IUPAC name: 2,2,2-trichloro-1,3,2lambda5-benzodioxaphosphole. InChIKey: PHDTZFMTDQJSSW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3O2P |
|---|---|
| Molecular weight | 245.4 g/mol |
| IUPAC name | 2,2,2-trichloro-1,3,2lambda5-benzodioxaphosphole |
| InChIKey | PHDTZFMTDQJSSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OP(O2)(Cl)(Cl)Cl |
Computed by PubChem (NCBI)