CAS 772-79-2 appears in our catalog under these names: 4-Chlorophenyl phosphorodichloridate, 97%, 4-Chlorophenyl Dichlorophosphate, 4–Chlorophenyl Phosphorodichloridate, 4-Chlorophenyl phosphorodichloridate, 98+% , 4-Chlorophenyl Phosphorodichloridate [Phosphorylating Agent], >97.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 1kg, 0,1kg.
1-chloro-4-dichlorophosphoryloxybenzene (CAS 772-79-2) is a chemical compound with the molecular formula C6H4Cl3O2P and a molecular weight of 245.4 g/mol. IUPAC name: 1-chloro-4-dichlorophosphoryloxybenzene. InChIKey: CCZMQYGSXWZFKI-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3O2P |
|---|---|
| Molecular weight | 245.4 g/mol |
| IUPAC name | 1-chloro-4-dichlorophosphoryloxybenzene |
| InChIKey | CCZMQYGSXWZFKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OP(=O)(Cl)Cl)Cl |
Computed by PubChem (NCBI)