CAS 2007909-33-1 appears in our catalog under these names: Methyl 2-(2,4-dichlorophenyl)-3,4-dihydro-2h-benzo[b][1,4]oxazine-6-carboxylate, 95%, Methyl 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-benzo(b)(1,4)oxazine-6-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate (CAS 2007909-33-1) is a chemical compound with the molecular formula C16H13Cl2NO3 and a molecular weight of 338.2 g/mol. IUPAC name: methyl 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate. InChIKey: NDPLWEVRTZYPAT-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO3 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | methyl 2-(2,4-dichlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylate |
| InChIKey | NDPLWEVRTZYPAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(CN2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)