Products 22212-56-2
CAS 22212-56-2 is the registry number for Benzoylprop. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1g.
2-(N-benzoyl-3,4-dichloroanilino)propanoic acid (CAS 22212-56-2) is a chemical compound with the molecular formula C16H13Cl2NO3 and a molecular weight of 338.2 g/mol. IUPAC name: 2-(N-benzoyl-3,4-dichloroanilino)propanoic acid. InChIKey: WZZRJCUYSKKFHO-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2NO3 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | 2-(N-benzoyl-3,4-dichloroanilino)propanoic acid |
| InChIKey | WZZRJCUYSKKFHO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N(C1=CC(=C(C=C1)Cl)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)