Products 2007919-48-2

CAS 2007919-48-2 is the registry number for 4-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenoxy)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenoxy]butanoic acid (CAS 2007919-48-2) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenoxy]butanoic acid. InChIKey: IOEAPGPRAFSEQF-UHFFFAOYSA-N.

Identity
Molecular formulaC25H23NO5
Molecular weight417.5 g/mol
IUPAC name4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenoxy]butanoic acid
InChIKeyIOEAPGPRAFSEQF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)OCCCC(=O)O

Computed by PubChem (NCBI)