CAS 2007919-56-2 appears in our catalog under these names: (S)-2-Amino-3-(tetrahydro-2H-pyran-4-yl)propanoic acid hydrochloride, 97%, (2S)–2–Amino–3–(oxan–4–yl)propanoic acid hydrochloride, (2S)-2-Amino-3-(oxan-4-yl)propanoic acid hydrochloride, (S)-2-Amino-3-(tetrahydro-2H-pyran-4-yl)propanoic Acid Hydrochloride, 97%, 97%, (2S)-2-amino-3-(oxan-4-yl)propanoic acid hydrochloride, 97%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 0,5g, 50mg, 100mg, 500mg, 5g.
(2S)-2-amino-3-(oxan-4-yl)propanoic acid;hydrochloride (CAS 2007919-56-2) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: (2S)-2-amino-3-(oxan-4-yl)propanoic acid;hydrochloride. InChIKey: QITCNNJBOQBHQP-FJXQXJEOSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2S)-2-amino-3-(oxan-4-yl)propanoic acid;hydrochloride |
| InChIKey | QITCNNJBOQBHQP-FJXQXJEOSA-N |
| SMILES | C1COCCC1C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)