Products 2007930-94-9

CAS 2007930-94-9 is the registry number for 3-(6-Methoxy-1h-indol-3-yl)-acrylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl (E)-3-(6-methoxy-1H-indol-3-yl)prop-2-enoate (CAS 2007930-94-9) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: ethyl (E)-3-(6-methoxy-1H-indol-3-yl)prop-2-enoate. InChIKey: NSJQTEWTTKBOKW-QPJJXVBHSA-N.

Identity
Molecular formulaC14H15NO3
Molecular weight245.27 g/mol
IUPAC nameethyl (E)-3-(6-methoxy-1H-indol-3-yl)prop-2-enoate
InChIKeyNSJQTEWTTKBOKW-QPJJXVBHSA-N
SMILESCCOC(=O)/C=C/C1=CNC2=C1C=CC(=C2)OC

Computed by PubChem (NCBI)