CAS 200801-70-3 appears in our catalog under these names: Tolterodine 5-Hydroxymethyl Analog Racemate, rac 5-Hydroxymethyl Tolterodine, 90% by HPLC, (Rac)–5–Hydroxymethyl Tolterodine, rac 5-Hydroxymethyl Tolterodine by HPLC, (Rac)-5-Hydroxymethyl Tolterodine 95+%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 5mg, 100mg, 1g, 10mM (in 1ml dmso), 500mg, 10g, 5g.
2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol (CAS 200801-70-3) is a chemical compound with the molecular formula C22H31NO2 and a molecular weight of 341.5 g/mol. IUPAC name: 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol. InChIKey: DUXZAXCGJSBGDW-UHFFFAOYSA-N.
| Molecular formula | C22H31NO2 |
|---|---|
| Molecular weight | 341.5 g/mol |
| IUPAC name | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol |
| InChIKey | DUXZAXCGJSBGDW-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC(C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C |
Computed by PubChem (NCBI)