CAS 63730-48-3 appears in our catalog under these names: Butorphanol Tartrate Impurity 3((-)-3-Methoxy Butorphanol), (-)-3-Methoxy Butorphanol. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.
(1S,9R,10S)-17-(cyclobutylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol (CAS 63730-48-3) is a chemical compound with the molecular formula C22H31NO2 and a molecular weight of 341.5 g/mol. IUPAC name: (1S,9R,10S)-17-(cyclobutylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol. InChIKey: DTVODKGBEXBXFW-BHIFYINESA-N.
| Molecular formula | C22H31NO2 |
|---|---|
| Molecular weight | 341.5 g/mol |
| IUPAC name | (1S,9R,10S)-17-(cyclobutylmethyl)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
| InChIKey | DTVODKGBEXBXFW-BHIFYINESA-N |
| SMILES | COC1=CC2=C(C[C@@H]3[C@]4([C@@]2(CCCC4)CCN3CC5CCC5)O)C=C1 |
Computed by PubChem (NCBI)