CAS 200807-46-1 is the registry number for 4-Chloro-n-(2,6-dichlorophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-N-(2,6-dichlorophenyl)benzamide (CAS 200807-46-1) is a chemical compound with the molecular formula C13H8Cl3NO and a molecular weight of 300.6 g/mol. IUPAC name: 4-chloro-N-(2,6-dichlorophenyl)benzamide. InChIKey: MGCCUXCCTBKJAN-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl3NO |
|---|---|
| Molecular weight | 300.6 g/mol |
| IUPAC name | 4-chloro-N-(2,6-dichlorophenyl)benzamide |
| InChIKey | MGCCUXCCTBKJAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)