CAS 56661-50-8 is the registry number for 4-Chloro-n-(3,4-dichlorophenyl)benzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-chloro-N-(3,4-dichlorophenyl)benzamide (CAS 56661-50-8) is a chemical compound with the molecular formula C13H8Cl3NO and a molecular weight of 300.6 g/mol. IUPAC name: 4-chloro-N-(3,4-dichlorophenyl)benzamide. InChIKey: ZUKGOIHTIKKVBD-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl3NO |
|---|---|
| Molecular weight | 300.6 g/mol |
| IUPAC name | 4-chloro-N-(3,4-dichlorophenyl)benzamide |
| InChIKey | ZUKGOIHTIKKVBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC(=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)