Products 2008546-36-7
CAS 2008546-36-7 is the registry number for (3-amino-3-methyl-pyrrolidin-1-yl)-phenyl-methanone, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3-amino-3-methylpyrrolidin-1-yl)-phenylmethanone (CAS 2008546-36-7) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: (3-amino-3-methylpyrrolidin-1-yl)-phenylmethanone. InChIKey: JGHAAVFJVHRQKN-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (3-amino-3-methylpyrrolidin-1-yl)-phenylmethanone |
| InChIKey | JGHAAVFJVHRQKN-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1)C(=O)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)